ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
330-94-9 4-(4-Fluorophenyl)-3-thiosemicarbazide |
|
Ürün Adı | 4-(4-Fluorophenyl)-3-thiosemicarbazide |
ingilizce adı | 4-(4-Fluorophenyl)-3-thiosemicarbazide;N-(4-fluorophenyl)hydrazinecarbothioamide |
Moleküler Formülü | C7H8FN3S |
Molekül Ağırlığı | 185.2219 |
InChI | InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS kayıt numarası | 330-94-9 |
Moleküler Yapısı | |
Yoğunluk | 1.418g/cm3 |
Kaynama noktası | 285°C at 760 mmHg |
Kırılma indisi | 1.696 |
Alevlenme noktası | 126.2°C |
Buhar basıncı | 0.00287mmHg at 25°C |
Risk Kodları | R25##Toxic if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |