ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-(Trifluoromethylsulfonyl)benzonitrile |
|
Ürün Adı | 4-(Trifluoromethylsulfonyl)benzonitrile |
ingilizce adı | 4-(Trifluoromethylsulfonyl)benzonitrile;4-Cyanophenyl trifluoromethyl sulphone;4-(Trifluoromethylsulphonyl)benzonitrile;4-(Trifluoromethanesulfonyl)benzonitrile |
Moleküler Formülü | C6H4FNO |
Molekül Ağırlığı | 125.1005 |
InChI | InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
CAS kayıt numarası | 312-21-0 |
Moleküler Yapısı | |
Yoğunluk | 1.269g/cm3 |
Ergime noktası | 84-88℃ |
Kaynama noktası | 166.5°C at 760 mmHg |
Kırılma indisi | 1.543 |
Alevlenme noktası | 54.5°C |
Buhar basıncı | 1.78mmHg at 25°C |
Risk Kodları | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |