ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-98-5 2- (2-tienil) -1,3-tiyazol-4-karbonil klorür |
|
Ürün Adı | 2- (2-tienil) -1,3-tiyazol-4-karbonil klorür |
Eş anlamlı | 2-tiyofen-2-il-1,3-tiyazol-4-karbonil klorür; |
ingilizce adı | 2-(2-thienyl)-1,3-thiazole-4-carbonyl chloride;2-thiophen-2-yl-1,3-thiazole-4-carbonyl chloride |
Moleküler Formülü | C8H4ClNOS2 |
Molekül Ağırlığı | 229.7065 |
InChI | InChI=1/C8H4ClNOS2/c9-7(11)5-4-13-8(10-5)6-2-1-3-12-6/h1-4H |
CAS kayıt numarası | 306934-98-5 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.498g/cm3 |
Ergime noktası | 90℃ |
Kaynama noktası | 371.6°C at 760 mmHg |
Kırılma indisi | 1.65 |
Alevlenme noktası | 178.5°C |
Buhar basıncı | 1.02E-05mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |