ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30506-30-0 1-Bromo-4-(ethylthio)benzene |
|
Ürün Adı | 1-Bromo-4-(ethylthio)benzene |
ingilizce adı | 1-Bromo-4-(ethylthio)benzene;4-Bromophenyl ethyl sulphide~4-(Ethylthio)bromobenzene;1-bromo-4-(ethylsulfanyl)benzene |
Moleküler Formülü | C8H9BrS |
Molekül Ağırlığı | 217.1261 |
InChI | InChI=1/C8H9BrS/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
CAS kayıt numarası | 30506-30-0 |
Moleküler Yapısı | |
Yoğunluk | 1.44g/cm3 |
Kaynama noktası | 259.1°C at 760 mmHg |
Kırılma indisi | 1.606 |
Alevlenme noktası | 110.5°C |
Buhar basıncı | 0.0214mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |