ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dichlorophenylhydrazine |
|
Ürün Adı | 2,5-Dichlorophenylhydrazine |
ingilizce adı | 2,5-Dichlorophenylhydrazine ;-2,5-DICHLOROPHENYLHYDRAZINE;1-(2,5-DICHLOROPHENYL)HYDRAZINE;(2,5-dichlorophenyl)-hydrazin;Hydrazine, (2,5-dichlorophenyl)-;2,5-DICHLOROPHENYLHYRAZINE |
Moleküler Formülü | C6H6Cl2N2 |
Molekül Ağırlığı | 177.0312 |
InChI | InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
CAS kayıt numarası | 305-15-7 |
EINECS | 206-163-6 |
Moleküler Yapısı | |
Yoğunluk | 1.475g/cm3 |
Ergime noktası | 100-104℃ |
Kaynama noktası | 266.8°C at 760 mmHg |
Kırılma indisi | 1.665 |
Alevlenme noktası | 115.1°C |
Buhar basıncı | 0.00848mmHg at 25°C |
Tehlike Sembolleri | Xi##Irritant:; |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |