ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride |
|
Ürün Adı | 2-chloro-6-methylpyridine-4-carbonyl chloride |
ingilizce adı | 2-chloro-6-methylpyridine-4-carbonyl chloride; |
Moleküler Formülü | C7H5Cl2NO |
Molekül Ağırlığı | 190.0267 |
InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
CAS kayıt numarası | 26413-58-1 |
Moleküler Yapısı | |
Yoğunluk | 1.384g/cm3 |
Kaynama noktası | 270.3°C at 760 mmHg |
Kırılma indisi | 1.558 |
Alevlenme noktası | 117.3°C |
Buhar basıncı | 0.00688mmHg at 25°C |
Tehlike Sembolleri | C##Corrosive:; |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |