ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
239-35-0 1,2-benzodiphenylene sulfide |
|
Ürün Adı | 1,2-benzodiphenylene sulfide |
ingilizce adı | 1,2-benzodiphenylene sulfide;11-thiabenzo(a)fluorene;1,2-benzo-9-thiafluorene;naphtho(1,2:2,3)thionaphthen;benzo[b]naphtho[2,1-d]thiophene |
Moleküler Formülü | C16H10S |
Molekül Ağırlığı | 234.3156 |
InChI | InChI=1/C16H10S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10H |
CAS kayıt numarası | 239-35-0 |
EINECS | 205-948-0 |
Moleküler Yapısı | |
Yoğunluk | 1.292g/cm3 |
Ergime noktası | 188-190℃ |
Kaynama noktası | 434.3°C at 760 mmHg |
Kırılma indisi | 1.809 |
Alevlenme noktası | 163°C |
Buhar basıncı | 2.44E-07mmHg at 25°C |
Güvenlik Açıklaması | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |