ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Phenanthridine |
|
Ürün Adı | Phenanthridine |
ingilizce adı | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
Moleküler Formülü | C13H9N |
Molekül Ağırlığı | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS kayıt numarası | 229-87-8 |
EINECS | 205-934-4 |
Moleküler Yapısı | |
Yoğunluk | 1.187g/cm3 |
Ergime noktası | 104-107℃ |
Kaynama noktası | 340.8°C at 760 mmHg |
Kırılma indisi | 1.726 |
Alevlenme noktası | 155.9°C |
Buhar basıncı | 0.000166mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R40##Possible risks of irreversible effects.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |