ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
215-58-7 1,2,3,4-Dibenzanthracene |
|
Ürün Adı | 1,2,3,4-Dibenzanthracene |
ingilizce adı | 1,2,3,4-Dibenzanthracene;Dibenz[a,c]anthracene;dibenz(a,c)anthracene;1,2:3,4-dibenzanthracene;Benztriphenylene;2,3-Benztriphenylene;benzo[f]tetraphene |
Moleküler Formülü | C22H14 |
Molekül Ağırlığı | 278.3466 |
InChI | InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
CAS kayıt numarası | 215-58-7 |
EINECS | 205-920-8 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.232g/cm3 |
Ergime noktası | 202-207℃ |
Kaynama noktası | 518°C at 760 mmHg |
Kırılma indisi | 1.811 |
Alevlenme noktası | 264.5°C |
Buhar basıncı | 2.55E-10mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R40##Possible risks of irreversible effects.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |