ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21010-06-0 5-(2-Thienyl)-pentanoic acid |
|
Ürün Adı | 5-(2-Thienyl)-pentanoic acid |
ingilizce adı | 5-(2-Thienyl)-pentanoic acid;5-(2-Thienyl)pentanoic acid;5-(2-Thienyl)valeric acid;5-(thiophen-2-yl)pentanoic acid |
Moleküler Formülü | C9H12O2S |
Molekül Ağırlığı | 184.2554 |
InChI | InChI=1/C9H12O2S/c10-9(11)6-2-1-4-8-5-3-7-12-8/h3,5,7H,1-2,4,6H2,(H,10,11) |
CAS kayıt numarası | 21010-06-0 |
Moleküler Yapısı | |
Yoğunluk | 1.182g/cm3 |
Kaynama noktası | 336.8°C at 760 mmHg |
Kırılma indisi | 1.549 |
Alevlenme noktası | 157.5°C |
Buhar basıncı | 4.29E-05mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |