ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
19819-98-8 2-Methylphenethyl alcohol |
|
Ürün Adı | 2-Methylphenethyl alcohol |
ingilizce adı | 2-Methylphenethyl alcohol;2-o-tolylethanol;2-(2-Methylphenyl)ethanol |
Moleküler Formülü | C9H12O |
Molekül Ağırlığı | 136.191 |
InChI | InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS kayıt numarası | 19819-98-8 |
EINECS | 243-349-6 |
Moleküler Yapısı | |
Yoğunluk | 1.001g/cm3 |
Kaynama noktası | 243.5°C at 760 mmHg |
Kırılma indisi | 1.532 |
Alevlenme noktası | 108.3°C |
Buhar basıncı | 0.0172mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |