ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18738-11-9 12-hidroksioleik asit, 2-aminoetanol (1:1) içeren bileşik |
|
Ürün Adı | 12-hidroksioleik asit, 2-aminoetanol (1:1) içeren bileşik |
Eş anlamlı | 9-Oktadekenoik asit, 12-hidroksi-, (9Z, 12R) -, compd.2-aminoetanol (1:1) ile; Asit 12-hidroksioléique, avec 2-aminoetanol (1: 1) oluşturur; Risinoleik asit, monoetanolamin tuzu; 12-Hidroksioleik asit, 2-aminoetanol (1:1) ile bileşik; (9Z, 12R) -12-hidroksioktadek-9-enoik asit - 2-aminoetanol (1: 1); |
ingilizce adı | 12-hydroxyoleic acid, compound with 2-aminoethanol (1:1);9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, compd. with 2-aminoethanol (1:1);Acide 12-hydroxyoléique, compose avec 2-aminoéthanol (1:1);Ricinoleic acid, monoethanolamine-salt;12-Hydroxyoleic acid, compound with 2-aminoethanol (1:1);(9Z,12R)-12-hydroxyoctadec-9-enoic acid - 2-aminoethanol (1:1) |
Moleküler Formülü | C20H41NO4 |
Molekül Ağırlığı | 359.5438 |
InChI | InChI=1/C18H34O3.C2H7NO/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;3-1-2-4/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);4H,1-3H2/b12-9-;/t17-;/m1./s1 |
CAS kayıt numarası | 18738-11-9 |
EINECS | 242-546-4 |
Moleküler Yapısı | |
Kaynama noktası | 416.4°C at 760 mmHg |
Alevlenme noktası | 219.8°C |
Buhar basıncı | 1.12E-08mmHg at 25°C |
MSDS |