ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18662-53-8 Nitrilotriacetic acid, trisodium salt, monohydrate |
|
Ürün Adı | Nitrilotriacetic acid, trisodium salt, monohydrate |
ingilizce adı | Nitrilotriacetic acid, trisodium salt, monohydrate;Nitrilotriacetic acid trisodium salt monohydrate;Nitriloacetic acid trisodium salt monohydrate;sodium 2,2',2''-nitrilotriacetate hydrate (3:1:1);NTA-3Na monohydrate |
Moleküler Formülü | C6H8NNa3O7 |
Molekül Ağırlığı | 275.0995 |
InChI | InChI=1/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
CAS kayıt numarası | 18662-53-8 |
EINECS | 205-355-7 |
Moleküler Yapısı | ![]() |
Ergime noktası | 320℃ |
Kaynama noktası | 498.2°C at 760 mmHg |
Alevlenme noktası | 255.1°C |
Buhar basıncı | 2.78E-11mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |