ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-72-6 2-acetyl-3-methylthiophene |
|
Ürün Adı | 2-acetyl-3-methylthiophene |
ingilizce adı | 2-acetyl-3-methylthiophene;1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
Moleküler Formülü | C7H8OS |
Molekül Ağırlığı | 140.2028 |
InChI | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
CAS kayıt numarası | 13679-72-6 |
EINECS | 237-179-1 |
Moleküler Yapısı | |
Yoğunluk | 1.106g/cm3 |
Kaynama noktası | 214.9°C at 760 mmHg |
Kırılma indisi | 1.535 |
Alevlenme noktası | 92.3°C |
Buhar basıncı | 0.152mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |