ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13090-86-3 benzoik asit, 2,2',2''-nitrilotrietanol (1:1) içeren bileşik |
|
Ürün Adı | benzoik asit, 2,2',2''-nitrilotrietanol (1:1) içeren bileşik |
Eş anlamlı | Benzoik asit, 2,2',2''-nitrilotrietanol (1:1) ile bileşik; Benzoik asit, compd.2,2 ', 2 ''-nitrilotris (etanol) (1: 1) ile; 2-hidroksi-N, N-bis (2-hidroksietil) etanaminyum benzoat; |
ingilizce adı | benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate |
Moleküler Formülü | C13H21NO5 |
Molekül Ağırlığı | 271.3095 |
InChI | InChI=1/C7H6O2.C6H15NO3/c8-7(9)6-4-2-1-3-5-6;8-4-1-7(2-5-9)3-6-10/h1-5H,(H,8,9);8-10H,1-6H2 |
CAS kayıt numarası | 13090-86-3 |
EINECS | 236-002-5 |
Moleküler Yapısı | |
Kaynama noktası | 518.5°C at 760 mmHg |
Alevlenme noktası | 267.4°C |
Buhar basıncı | 1.41E-11mmHg at 25°C |
MSDS |