ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1206-15-1 1- (4-Metoksifenil) -1-siklopentatankarbonitril |
|
Ürün Adı | 1- (4-Metoksifenil) -1-siklopentatankarbonitril |
Eş anlamlı | 1- (4-Metoksifenil) siklopentankarbonitril |
ingilizce adı | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
Moleküler Formülü | C13H15NO |
Molekül Ağırlığı | 201.2643 |
InChI | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS kayıt numarası | 1206-15-1 |
EINECS | 214-890-5 |
Moleküler Yapısı | |
Yoğunluk | 1.07g/cm3 |
Kaynama noktası | 346.4°C at 760 mmHg |
Kırılma indisi | 1.543 |
Alevlenme noktası | 146.2°C |
Buhar basıncı | 5.76E-05mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |