114-33-0 N-Methylnicotinamide |
Ürün Adı |
N-Methylnicotinamide |
ingilizce adı |
N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
Moleküler Formülü |
C7H8N2O |
Molekül Ağırlığı |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
CAS kayıt numarası |
114-33-0 |
EINECS |
204-046-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.106g/cm3 |
Ergime noktası |
100-105℃ |
Kaynama noktası |
347.7°C at 760 mmHg |
Kırılma indisi |
1.529 |
Alevlenme noktası |
164.1°C |
Buhar basıncı |
5.3E-05mmHg at 25°C |
Tehlike Sembolleri |
Xi##Irritant:;
|
Risk Kodları |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
Güvenlik Açıklaması |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |