ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112-61-8 Methyl stearate |
|
Ürün Adı | Methyl stearate |
ingilizce adı | Methyl stearate;Methyl n-octadecanoate;Stearic acid methyl ester;methyl octadecanoate;Me-ST |
Moleküler Formülü | C19H38O2 |
Molekül Ağırlığı | 298.5038 |
InChI | InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
CAS kayıt numarası | 112-61-8 |
EINECS | 203-990-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.863g/cm3 |
Ergime noktası | 37-39℃ |
Kaynama noktası | 355.5°C at 760 mmHg |
Kırılma indisi | 1.444 |
Alevlenme noktası | 169.3°C |
Buhar basıncı | 3.11E-05mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |