Chemindex > 110-49-6
TR ▼
2-Methoxyethyl acetate |
|
| Ürün Adı | 2-Methoxyethyl acetate |
| ingilizce adı | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| Moleküler Formülü | C4H8O2S |
| Molekül Ağırlığı | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| CAS kayıt numarası | 110-49-6 |
| EINECS | 203-772-9 |
| Moleküler Yapısı |  |
| Yoğunluk | 1.072g/cm3 |
| Ergime noktası | -65℃ |
| Kaynama noktası | 162.7°C at 760 mmHg |
| Kırılma indisi | 1.452 |
| Alevlenme noktası | 57.6°C |
| Buhar basıncı | 2.14mmHg at 25°C |
| Tehlike Sembolleri |  T##Toxic:; |
| Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| Güvenlik Açıklaması | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
Chemical CAS Veritabanı Hizmeti, ChemIndex.com tarafından sağlanmaktadır. 