ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
butyl myristate |
|
Ürün Adı | butyl myristate |
ingilizce adı | butyl myristate;n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester;Myristicacidnbutylester;Myristic acid n-butyl ester;butyl tetradecanoate |
Moleküler Formülü | C18H36O2 |
Molekül Ağırlığı | 284.4772 |
InChI | InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
CAS kayıt numarası | 110-36-1 |
EINECS | 203-759-8 |
Moleküler Yapısı | |
Yoğunluk | 0.864g/cm3 |
Kaynama noktası | 334.7°C at 760 mmHg |
Kırılma indisi | 1.442 |
Alevlenme noktası | 158.5°C |
Buhar basıncı | 0.000126mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |