ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-31-7 1-Hexyn-3-ol |
|
Ürün Adı | 1-Hexyn-3-ol |
ingilizce adı | 1-Hexyn-3-ol;Ethynyl n-propyl carbinol;hex-1-yn-3-ol;(3S)-hex-1-yn-3-ol;(3R)-hex-1-yn-3-ol |
Moleküler Formülü | C6H10O |
Molekül Ağırlığı | 98.143 |
InChI | InChI=1/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1 |
CAS kayıt numarası | 105-31-7 |
EINECS | 203-286-7 |
Moleküler Yapısı | |
Yoğunluk | 0.898g/cm3 |
Kaynama noktası | 140.3°C at 760 mmHg |
Kırılma indisi | 1.446 |
Alevlenme noktası | 42.7°C |
Buhar basıncı | 2.54mmHg at 25°C |
Risk Kodları | R10##Flammable.||R25##Toxic if swallowed.||R27##Very toxic in contact with skin.:; |
Güvenlik Açıklaması | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |