ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-08-8 1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
Ürün Adı | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
ingilizce adı | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
Moleküler Formülü | C8H16O2 |
Molekül Ağırlığı | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS kayıt numarası | 105-08-8 |
EINECS | 203-268-9 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.004g/cm3 |
Ergime noktası | 31.5℃ |
Kaynama noktası | 286.2°C at 760 mmHg |
Kırılma indisi | 1.47 |
Alevlenme noktası | 161.1°C |
Suda çözünürlük | miscible |
Buhar basıncı | 0.000303mmHg at 25°C |
Risk Kodları | R36:; |
Güvenlik Açıklaması | S26||S39:; |
MSDS |