ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-94-6 4-Nitrophenyloxamic acid |
|
Ürün Adı | 4-Nitrophenyloxamic acid |
ingilizce adı | 4-Nitrophenyloxamic acid;4-Nitrooxanilic acid;[(4-nitrophenyl)amino](oxo)acetic acid |
Moleküler Formülü | C8H6N2O5 |
Molekül Ağırlığı | 210.1436 |
InChI | InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
CAS kayıt numarası | 103-94-6 |
EINECS | 203-160-1 |
Moleküler Yapısı | |
Yoğunluk | 1.629g/cm3 |
Kırılma indisi | 1.678 |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |