ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
cyclohexylacetone |
|
Ürün Adı | cyclohexylacetone |
ingilizce adı | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
Moleküler Formülü | C9H16O |
Molekül Ağırlığı | 140.2227 |
InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
CAS kayıt numarası | 103-78-6 |
EINECS | 203-143-9 |
Moleküler Yapısı | |
Yoğunluk | 0.889g/cm3 |
Kaynama noktası | 188.1°C at 760 mmHg |
Kırılma indisi | 1.441 |
Alevlenme noktası | 65.3°C |
Buhar basıncı | 0.609mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |