ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-85-2 Tributyl phosphite |
|
Ürün Adı | Tributyl phosphite |
ingilizce adı | Tributyl phosphite;Tri-n-butyl phosphite |
Moleküler Formülü | C12H27O3P |
Molekül Ağırlığı | 250.3147 |
InChI | InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
CAS kayıt numarası | 102-85-2 |
EINECS | 203-061-3 |
Moleküler Yapısı | |
Ergime noktası | -80℃ |
Kaynama noktası | 268.1°C at 760 mmHg |
Alevlenme noktası | 121.1°C |
Buhar basıncı | 0.013mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R21##Harmful in contact with skin.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |