ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
Ürün Adı | N-Phenylurethane |
ingilizce adı | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
Moleküler Formülü | C9H11NO2 |
Molekül Ağırlığı | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
CAS kayıt numarası | 101-99-5 |
EINECS | 202-995-9 |
Moleküler Yapısı | |
Yoğunluk | 1.136g/cm3 |
Kaynama noktası | 238°C at 760 mmHg |
Kırılma indisi | 1.558 |
Alevlenme noktası | 79.2°C |
Buhar basıncı | 0.0434mmHg at 25°C |
Risk Kodları | R40##Possible risks of irreversible effects.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |