ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-81-5 MCPB |
|
اسم المنتج | MCPB |
الاسم بالانجليزية | MCPB;4-(4-Chloro-o-tolyloxy)butyric acid;2,4-MCPB;4-(4-Chloro-2-methylphenoxy)butyric acid;MCPB;4-(2-Methyl-4-chlorophenoxy)butyric acid;2-(4-chloro-2-methylphenoxy)butanoic acid |
الصيغة الجزيئية | C11H13ClO3 |
الوزن الجزيئي الغرامي | 228.6721 |
InChI | InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
إستراتيجية المساعدة القطرية | 94-81-5 |
المفوضية الأوروبية رقم | 202-365-3 |
بنية جزيئية | |
كثافة | 1.228g/cm3 |
نقطة الغليان | 345.1°C at 760 mmHg |
معامل الإنكسار | 1.536 |
نقطة الوميض | 162.5°C |
ضغط البخار | 2.39E-05mmHg at 25°C |
خطر المصطلحات | R22##Harmful if swallowed.:; |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |