ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Aminohippuric acid, sodium salt monohydrate |
|
اسم المنتج | 4-Aminohippuric acid, sodium salt monohydrate |
الاسم بالانجليزية | 4-Aminohippuric acid, sodium salt monohydrate;4-Aminohippuric acid sodium salt hydrate;Sodium 4-aminohippurate hydrate;Aminohippurate Sodium;sodium [(4-aminobenzoyl)amino]acetate |
الصيغة الجزيئية | C9H9N2NaO3 |
الوزن الجزيئي الغرامي | 216.1691 |
InChI | InChI=1/C9H10N2O3.Na/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13;/h1-4H,5,10H2,(H,11,14)(H,12,13);/q;+1/p-1 |
إستراتيجية المساعدة القطرية | 94-16-6 |
المفوضية الأوروبية رقم | 202-309-8 |
بنية جزيئية | |
درجة الإنصهار | 123-125℃ |
نقطة الغليان | 517.2°C at 760 mmHg |
نقطة الوميض | 266.6°C |
ضغط البخار | 1.6E-11mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |