ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-(4-Chloro-2-methylphenoxy)propionic acid |
|
اسم المنتج | 2-(4-Chloro-2-methylphenoxy)propionic acid |
الاسم بالانجليزية | 2-(4-Chloro-2-methylphenoxy)propionic acid;2-(4-Chloro-o-tolyloxy)propionic acid;MCPP;Mecoprop;(-)-2-(4-chloro-o-tolyloxy)propionic acid;(2S)-2-(4-chloro-2-methylphenoxy)propanoic acid |
الصيغة الجزيئية | C10H11ClO3 |
الوزن الجزيئي الغرامي | 214.6455 |
InChI | InChI=1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m0/s1 |
إستراتيجية المساعدة القطرية | 93-65-2 |
المفوضية الأوروبية رقم | 202-264-4;230-386-8 [1] |
بنية جزيئية | |
كثافة | 1.265g/cm3 |
نقطة الغليان | 331.9°C at 760 mmHg |
معامل الإنكسار | 1.542 |
نقطة الوميض | 154.5°C |
الذوبان في الماء | 734 mg l-1 |
ضغط البخار | 6.04E-05mmHg at 25°C |
خطر المصطلحات | R22##Harmful if swallowed.||R38##Irritating to skin.||R41##Risks of serious damage to eyes.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |