ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
|
اسم المنتج | Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
الاسم بالانجليزية | Benzene, 1,2-dimethoxy-4-(1-propenyl)-;1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ;1,2-dimethoxy-4-(prop-1-en-1-yl)benzene;2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol;2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1);1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
الصيغة الجزيئية | C11H14O2 |
الوزن الجزيئي الغرامي | 178.2277 |
InChI | InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
إستراتيجية المساعدة القطرية | 93-16-3 |
المفوضية الأوروبية رقم | 202-224-6 |
بنية جزيئية | |
كثافة | 0.998g/cm3 |
درجة الإنصهار | 62.6℃ |
نقطة الغليان | 271.1°C at 760 mmHg |
معامل الإنكسار | 1.534 |
نقطة الوميض | 104.5°C |
ضغط البخار | 0.011mmHg at 25°C |
خطر المصطلحات | R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |