ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
L(+)tartaric acid dipotassium |
|
اسم المنتج | L(+)tartaric acid dipotassium |
الاسم بالانجليزية | L(+)tartaric acid dipotassium;dipotassium tartrate;L-Tartaric acid dipotassium salt;potassium tartrate |
الصيغة الجزيئية | K2C4H4O6 |
الوزن الجزيئي الغرامي | 226.266 |
InChI | InChI=1/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
إستراتيجية المساعدة القطرية | 921-53-9 |
المفوضية الأوروبية رقم | 213-067-8 |
بنية جزيئية | |
كثافة | 1.98 |
شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |