ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha-Phenylcinnamic acid |
|
اسم المنتج | alpha-Phenylcinnamic acid |
الاسم بالانجليزية | alpha-Phenylcinnamic acid;a-Phenyl-trans-cinnamic acid, Pract.;a-(Phenylmethylene)benzeneacetic acid, Pract.;Phenylcinnamicacid,98%;(2E)-2,3-diphenylprop-2-enoic acid;2,3-diphenylprop-2-enoic acid;(2Z)-2,3-diphenylprop-2-enoic acid;(2E)-2,3-diphenylprop-2-enoate;(2Z)-2,3-diphenylprop-2-enoate |
الصيغة الجزيئية | C15H11O2 |
الوزن الجزيئي الغرامي | 223.2472 |
InChI | InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
إستراتيجية المساعدة القطرية | 91-48-5 |
المفوضية الأوروبية رقم | 202-069-4 |
بنية جزيئية | |
درجة الإنصهار | 171-175℃ |
نقطة الغليان | 336.6°C at 760 mmHg |
نقطة الوميض | 239.8°C |
ضغط البخار | 4.35E-05mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |