ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Bromobenzophenone |
|
اسم المنتج | 4-Bromobenzophenone |
الاسم بالانجليزية | 4-Bromobenzophenone;Benzophenone, 4-bromo-;4-07-00-01378 (Beilstein Handbook Reference);4-Bromophenyl phenyl ketone;BRN 1910182;NSC 59863;USAF DO-3;p-Benzoylbromobenzene;p-Bromobenzophenone;Methanone, (4-bromophenyl)phenyl-;Methanone, (4-bromophenyl)phenyl- (9CI);(4-bromophenyl)(phenyl)methanone |
الصيغة الجزيئية | C13H9BrO |
الوزن الجزيئي الغرامي | 261.114 |
InChI | InChI=1/C13H9BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
إستراتيجية المساعدة القطرية | 90-90-4 |
المفوضية الأوروبية رقم | 202-024-9 |
بنية جزيئية | |
كثافة | 1.421g/cm3 |
درجة الإنصهار | 78-82℃ |
نقطة الغليان | 346.8°C at 760 mmHg |
معامل الإنكسار | 1.61 |
نقطة الوميض | 81.3°C |
ضغط البخار | 5.62E-05mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |