ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone |
|
اسم المنتج | 2-Hydroxy-4,6-dimethoxyacetophenone |
الاسم بالانجليزية | 2-Hydroxy-4,6-dimethoxyacetophenone;xanthoxylin |
الصيغة الجزيئية | C10H12O4 |
الوزن الجزيئي الغرامي | 196.1999 |
InChI | InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
إستراتيجية المساعدة القطرية | 90-24-4 |
المفوضية الأوروبية رقم | 201-978-3 |
بنية جزيئية | ![]() |
كثافة | 1.172g/cm3 |
درجة الإنصهار | 80-82℃ |
نقطة الغليان | 355.1°C at 760 mmHg |
معامل الإنكسار | 1.527 |
نقطة الوميض | 141.2°C |
ضغط البخار | 1.57E-05mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |