ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
88920-78-9 1-(3,4-dimethoxyphenyl)ethan-1-one oxime |
|
اسم المنتج | 1-(3,4-dimethoxyphenyl)ethan-1-one oxime |
الاسم بالانجليزية | 1-(3,4-dimethoxyphenyl)ethan-1-one oxime;1-(3,4-dimethoxyphenyl)ethanone oxime |
الصيغة الجزيئية | C10H13NO3 |
الوزن الجزيئي الغرامي | 195.2151 |
InChI | InChI=1/C10H13NO3/c1-7(11-12)8-4-5-9(13-2)10(6-8)14-3/h4-6,12H,1-3H3 |
إستراتيجية المساعدة القطرية | 88920-78-9 |
بنية جزيئية | |
كثافة | 1.1g/cm3 |
درجة الإنصهار | 147℃ |
نقطة الغليان | 321.3°C at 760 mmHg |
معامل الإنكسار | 1.5 |
نقطة الوميض | 148.1°C |
ضغط البخار | 0.000124mmHg at 25°C |
علامات على البضائع الخطرة | Xi##Irritant:; |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |