ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
phthalamic acid |
|
اسم المنتج | phthalamic acid |
الاسم بالانجليزية | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
الصيغة الجزيئية | C8H7NO3 |
الوزن الجزيئي الغرامي | 165.1461 |
InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
إستراتيجية المساعدة القطرية | 88-97-1 |
المفوضية الأوروبية رقم | 201-871-1 |
بنية جزيئية | |
كثافة | 1.368g/cm3 |
نقطة الغليان | 394.2°C at 760 mmHg |
معامل الإنكسار | 1.615 |
نقطة الوميض | 192.2°C |
ضغط البخار | 6.38E-07mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |