ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-86-8 2,5-dichloro-3-nitrobenzoic acid |
|
اسم المنتج | 2,5-dichloro-3-nitrobenzoic acid |
الاسم بالانجليزية | 2,5-dichloro-3-nitrobenzoic acid;Benzoic acid, 2,5-dichloro-3-nitro-;2,5-Dichloro-3-nitrobenzoic acid;2,5-Dichloro-4-nitrobenzoic acid;2-09-00-00276 (Beilstein Handbook Reference);3-Nitro-2,5-dichlorobenzoic acid;BRN 1976119;Caswell No. 312;Dinoben;EPA Pesticide Chemical Code 028101;Kyselina 2,5-dichlor-3-nitrobenzoova;Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
الصيغة الجزيئية | C7H3Cl2NO4 |
الوزن الجزيئي الغرامي | 236.009 |
InChI | InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
إستراتيجية المساعدة القطرية | 88-86-8 |
المفوضية الأوروبية رقم | 201-862-2 |
بنية جزيئية | |
كثافة | 1.713g/cm3 |
درجة الإنصهار | 216-220℃ |
نقطة الغليان | 366.5°C at 760 mmHg |
معامل الإنكسار | 1.638 |
نقطة الوميض | 175.5°C |
ضغط البخار | 5.11E-06mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |