ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
7-Ethoxy-4-methylcoumarin |
|
اسم المنتج | 7-Ethoxy-4-methylcoumarin |
الاسم بالانجليزية | 7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one;Ethyl 4-methylumbelliferyl ether |
الصيغة الجزيئية | C12H12O3 |
الوزن الجزيئي الغرامي | 204.2219 |
InChI | InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
إستراتيجية المساعدة القطرية | 87-05-8 |
المفوضية الأوروبية رقم | 201-721-5 |
بنية جزيئية | |
كثافة | 1.163g/cm3 |
درجة الإنصهار | 113-114℃ |
نقطة الغليان | 351.4°C at 760 mmHg |
معامل الإنكسار | 1.548 |
نقطة الوميض | 146.2°C |
ضغط البخار | 4.12E-05mmHg at 25°C |
شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |