ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
|
اسم المنتج | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
الاسم بالانجليزية | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-;NSC 68230;2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde;Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde;2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
الصيغة الجزيئية | C13H19NO |
الوزن الجزيئي الغرامي | 205.2961 |
InChI | InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
إستراتيجية المساعدة القطرية | 83-18-1 |
المفوضية الأوروبية رقم | 201-458-6 |
بنية جزيئية | |
كثافة | 1.07g/cm3 |
نقطة الغليان | 345.8°C at 760 mmHg |
معامل الإنكسار | 1.559 |
نقطة الوميض | 163°C |
ضغط البخار | 6E-05mmHg at 25°C |
شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |