ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dichlorohydroquinone |
|
اسم المنتج | 2,5-Dichlorohydroquinone |
الاسم بالانجليزية | 2,5-Dichlorohydroquinone;2,5-Dichloro-1,4-dihydroxybenzene;2,5-Dichloro-1,4-hydroquinone;2,5-Dichloro-p-benzohydroquinone;2,5-Dichloro-p-hydroquinone;CCRIS 5677;NSC 48667;1,4-Benzenediol, 2,5-dichloro-;Hydroquinone, 2,5-dichloro- (8CI);2,5-dichlorobenzene-1,4-diol |
الصيغة الجزيئية | C6H4Cl2O2 |
الوزن الجزيئي الغرامي | 179.0008 |
InChI | InChI=1/C6H4Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H |
إستراتيجية المساعدة القطرية | 824-69-1 |
المفوضية الأوروبية رقم | 212-533-8 |
بنية جزيئية | |
كثافة | 1.624g/cm3 |
درجة الإنصهار | 167-174℃ |
نقطة الغليان | 274°C at 760 mmHg |
معامل الإنكسار | 1.642 |
نقطة الوميض | 119.5°C |
ضغط البخار | 0.00332mmHg at 25°C |
علامات على البضائع الخطرة | C##Corrosive:; |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |