ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene |
|
اسم المنتج | 1-(chloromethyl)-2,4-dimethylbenzene |
الاسم بالانجليزية | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
الصيغة الجزيئية | C9H11Cl |
الوزن الجزيئي الغرامي | 154.6366 |
InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
إستراتيجية المساعدة القطرية | 824-55-5 |
المفوضية الأوروبية رقم | 212-531-7 |
بنية جزيئية | ![]() |
كثافة | 1.033g/cm3 |
نقطة الغليان | 215.5°C at 760 mmHg |
معامل الإنكسار | 1.522 |
نقطة الوميض | 86.5°C |
ضغط البخار | 0.216mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R34##Causes burns.||R36##Irritating to eyes.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |