ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
trans-1,2-Dichlorocyclohexane |
|
اسم المنتج | trans-1,2-Dichlorocyclohexane |
الاسم بالانجليزية | trans-1,2-Dichlorocyclohexane;Dychlorocyclohexane;trans-1,2-Dychlorocyclohexane;1,2-dichlorocyclohexane;(1R,2R)-1,2-dichlorocyclohexane;(1R)-1,2-dichlorocyclohexane |
الصيغة الجزيئية | C6H10Cl2 |
الوزن الجزيئي الغرامي | 153.0496 |
InChI | InChI=1/C6H10Cl2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6?/m1/s1 |
إستراتيجية المساعدة القطرية | 822-86-6 |
المفوضية الأوروبية رقم | 212-503-4 |
بنية جزيئية | |
كثافة | 1.14g/cm3 |
نقطة الغليان | 198°C at 760 mmHg |
معامل الإنكسار | 1.472 |
نقطة الوميض | 66.1°C |
ضغط البخار | 0.518mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |