ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,5-Dichloroanthraquinone |
|
اسم المنتج | 1,5-Dichloroanthraquinone |
الاسم بالانجليزية | 1,5-Dichloroanthraquinone;1,5-Dichloranthrachinon;1,5-Dichloranthrachinon [Czech];1,5-Dichloro-9,10-anthraquinone;9,10-Anthracenedione, 1,5-dichloro-;AI3-38301;NSC 13969;Anthraquinone, 1,5-dichloro-;1,5-dichloroanthracene-9,10-dione;1,5-Dichloro Anthraquinone |
الصيغة الجزيئية | C14H6Cl2O2 |
الوزن الجزيئي الغرامي | 277.1022 |
InChI | InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
إستراتيجية المساعدة القطرية | 82-46-2 |
المفوضية الأوروبية رقم | 201-424-0 |
بنية جزيئية | |
كثافة | 1.514g/cm3 |
درجة الإنصهار | 245-250℃ |
نقطة الغليان | 455.2°C at 760 mmHg |
معامل الإنكسار | 1.671 |
نقطة الوميض | 191.7°C |
ضغط البخار | 1.79E-08mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |