ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-38-2 diethyl glutarate |
|
اسم المنتج | diethyl glutarate |
الاسم بالانجليزية | diethyl glutarate;Diethyl glutarate, (Glutaric acid diethyl ester);Glutaric acid diethyl ester;Diethyl Pentanediate;diethyl pentanedioate |
الصيغة الجزيئية | C9H16O4 |
الوزن الجزيئي الغرامي | 188.2209 |
InChI | InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
إستراتيجية المساعدة القطرية | 818-38-2 |
المفوضية الأوروبية رقم | 212-451-2 |
بنية جزيئية | ![]() |
كثافة | 1.022g/cm3 |
نقطة الغليان | 236.5°C at 760 mmHg |
معامل الإنكسار | 1.427 |
نقطة الوميض | 96.1°C |
ضغط البخار | 0.0472mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |