ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,1-dichloro-2,2-difluoroethylene |
|
اسم المنتج | 1,1-dichloro-2,2-difluoroethylene |
الاسم بالانجليزية | 1,1-dichloro-2,2-difluoroethylene;FC-1112a;1-chloro-1,2,2-trifluoroethene |
الصيغة الجزيئية | C2Cl2F2 |
الوزن الجزيئي الغرامي | 132.9242 |
InChI | InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
إستراتيجية المساعدة القطرية | 79-35-6 |
المفوضية الأوروبية رقم | 201-198-3 |
بنية جزيئية | |
كثافة | 1.503g/cm3 |
نقطة الغليان | 17.3°C at 760 mmHg |
معامل الإنكسار | 1.392 |
ضغط البخار | 999mmHg at 25°C |
خطر المصطلحات | R23##Toxic by inhalation.||R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S23##Do not inhale gas/fumes/vapour/spray.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S9##Keep container in a well-ventilated place.:; |
MSDS |