ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76393-18-5 2,6-dibromo-4-(fluorophenyl)isocyanate |
|
اسم المنتج | 2,6-dibromo-4-(fluorophenyl)isocyanate |
الاسم بالانجليزية | 2,6-dibromo-4-(fluorophenyl)isocyanate; |
الصيغة الجزيئية | C7H2Br2FNO |
الوزن الجزيئي الغرامي | 294.9033 |
InChI | InChI=1/C7H2Br2FNO/c8-5-1-4(10)2-6(9)7(5)11-3-12/h1-2H |
إستراتيجية المساعدة القطرية | 76393-18-5 |
بنية جزيئية | |
كثافة | 2.01g/cm3 |
درجة الإنصهار | 42-45℃ |
نقطة الغليان | 295.5°C at 760 mmHg |
معامل الإنكسار | 1.614 |
نقطة الوميض | 132.5°C |
ضغط البخار | 0.00152mmHg at 25°C |
خطر المصطلحات | R20/22##Harmful by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
شروط الأمن | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |