ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
اسم المنتج | Bromodichloromethane |
الاسم بالانجليزية | Bromodichloromethane;FC-20B1 |
الصيغة الجزيئية | CHBrCl2 |
الوزن الجزيئي الغرامي | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
إستراتيجية المساعدة القطرية | 75-27-4 |
المفوضية الأوروبية رقم | 200-856-7 |
بنية جزيئية | ![]() |
كثافة | 2.013g/cm3 |
درجة الإنصهار | -55℃ |
نقطة الغليان | 89.7°C at 760 mmHg |
معامل الإنكسار | 1.503 |
نقطة الوميض | 1.3°C |
ضغط البخار | 65.3mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
شروط الأمن | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |