ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72856-73-6 2-methoxy-4-(methylthio)benzoic acid |
|
اسم المنتج | 2-methoxy-4-(methylthio)benzoic acid |
الاسم بالانجليزية | 2-methoxy-4-(methylthio)benzoic acid;4-(Methylthio)-o-anisic acid;2-methoxy-4-(methylsulfanyl)benzoic acid |
الصيغة الجزيئية | C9H10O3S |
الوزن الجزيئي الغرامي | 198.2389 |
InChI | InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
إستراتيجية المساعدة القطرية | 72856-73-6 |
المفوضية الأوروبية رقم | 276-948-6 |
بنية جزيئية | |
كثافة | 1.29g/cm3 |
نقطة الغليان | 342.3°C at 760 mmHg |
معامل الإنكسار | 1.592 |
نقطة الوميض | 160.8°C |
ضغط البخار | 2.92E-05mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |