ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
اسم المنتج | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
الاسم بالانجليزية | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
الصيغة الجزيئية | C14H10Cl4 |
الوزن الجزيئي الغرامي | 320.04 |
InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
إستراتيجية المساعدة القطرية | 72-54-8 |
المفوضية الأوروبية رقم | 200-783-0 |
بنية جزيئية | ![]() |
درجة الإنصهار | 109-111℃ |
علامات على البضائع الخطرة | |
خطر المصطلحات | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |