ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-18-4 L-Valine |
|
اسم المنتج | L-Valine |
الاسم بالانجليزية | L-Valine;L-2-Amino-3-methylbutyric acid;L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade;H-Val-OH;2-Amino-3-methylbutanoic acid;Lvaline;L-2-Aminoisovaleric acid;(S)-(+)-2-Amino-3-methylbutyric acid;1-2-Amino-3-methylbutyric acid;Valine |
الصيغة الجزيئية | C5H11NO2 |
الوزن الجزيئي الغرامي | 117.1478 |
InChI | InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
إستراتيجية المساعدة القطرية | 72-18-4;7004-03-7 |
المفوضية الأوروبية رقم | 200-773-6 |
بنية جزيئية | ![]() |
درجة الإنصهار | 315℃ |
معامل الإنكسار | 1.507 |
الذوبان في الماء | 85 g/L (20℃) |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |